EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:190044 - Ethylenediamine-N,N'-di-a-butyric acid
| Formula | C10H20N2O4 |
| Net Charge | 0 |
| Average Mass | 232.280 |
| Monoisotopic Mass | 232.14231 |
| SMILES | CCC(NCCNC(CC)C(=O)O)C(=O)O |
| InChI | InChI=1S/C10H20N2O4/c1-3-7(9(13)14)11-5-6-12-8(4-2)10(15)16/h7-8,11-12H,3-6H2,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | LLOPSLUNSGBASE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brassica napus (ncbitaxon:3708) | flower (BTO:0000469) | MetaboLights (MTBLS3950) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ethylenediamine-N,N'-di-a-butyric acid (CHEBI:190044) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-[2-(1-carboxypropylamino)ethylamino]butanoic acid |