EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:190040 - Ethyl 1-benzyl-3-hydroxy- 2-oxo[5H]pyrrole-4-carboxylate
| Formula | C14H15NO4 |
| Net Charge | 0 |
| Average Mass | 261.277 |
| Monoisotopic Mass | 261.10011 |
| SMILES | CCOC(=O)C1=C(O)C(=O)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C14H15NO4/c1-2-19-14(18)11-9-15(13(17)12(11)16)8-10-6-4-3-5-7-10/h3-7,16H,2,8-9H2,1H3 |
| InChIKey | IGYRPDIWSYGHMY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brassica napus (ncbitaxon:3708) | flower (BTO:0000469) | MetaboLights (MTBLS3950) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ethyl 1-benzyl-3-hydroxy- 2-oxo[5H]pyrrole-4-carboxylate (CHEBI:190040) is a carboxylic acid (CHEBI:33575) |
| Ethyl 1-benzyl-3-hydroxy- 2-oxo[5H]pyrrole-4-carboxylate (CHEBI:190040) is a pyrroline (CHEBI:23763) |
| IUPAC Name |
|---|
| ethyl 1-benzyl-4-hydroxy-5-oxo-2H-pyrrole-3-carboxylate |