EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:190017 - 4-Hydroxymethyl-3-methoxyphenoxyacetic acid
| Formula | C10H12O5 |
| Net Charge | 0 |
| Average Mass | 212.201 |
| Monoisotopic Mass | 212.06847 |
| SMILES | COc1cc(OCC(=O)O)ccc1CO |
| InChI | InChI=1S/C10H12O5/c1-14-9-4-8(15-6-10(12)13)3-2-7(9)5-11/h2-4,11H,5-6H2,1H3,(H,12,13) |
| InChIKey | ZKDXHLFLKKWCBY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | liver (BTO:0000759) | MetaboLights (MTBLS2279) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-Hydroxymethyl-3-methoxyphenoxyacetic acid (CHEBI:190017) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 2-[4-(hydroxymethyl)-3-methoxyphenoxy]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 118400 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:83590-77-6 | ChemIDplus |