EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H8NO5P |
| Net Charge | 0 |
| Average Mass | 169.073 |
| Monoisotopic Mass | 169.01401 |
| SMILES | N[C@@H](CP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C3H8NO5P/c4-2(3(5)6)1-10(7,8)9/h2H,1,4H2,(H,5,6)(H2,7,8,9)/t2-/m0/s1 |
| InChIKey | LBTABPSJONFLPO-REOHCLBHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | liver (BTO:0000759) | MetaboLights (MTBLS2279) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R)-2-amino-3-phosphonopropanoic acid (CHEBI:190016) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| (2R)-2-amino-3-phosphonopropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 154244 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:20263-06-3 | ChemIDplus |