EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H40O3 |
| Net Charge | 0 |
| Average Mass | 328.537 |
| Monoisotopic Mass | 328.29775 |
| SMILES | CCCCCC(O)CCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C20H40O3/c1-2-3-13-16-19(21)17-14-11-9-7-5-4-6-8-10-12-15-18-20(22)23/h19,21H,2-18H2,1H3,(H,22,23) |
| InChIKey | BLERHOKJGPAHCL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| marine plankton environmental sample (ncbitaxon:632957) | endometabolome | MetaboLights (MTBLS3038) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 15-hydroxyicosanoic acid (CHEBI:189996) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| 15-hydroxyicosanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 103176 | ChemSpider |
| HMDB0061665 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:73179-99-4 | ChemIDplus |