EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O2 |
| Net Charge | 0 |
| Average Mass | 304.474 |
| Monoisotopic Mass | 304.24023 |
| SMILES | [H][C@]12CC[C@@]3([H])[C@]4([H])CC[C@@](C)(O)[C@@]4(C)CC[C@]3([H])[C@@]1(C)C=C[C@@H](O)C2 |
| InChI | InChI=1S/C20H32O2/c1-18-9-6-14(21)12-13(18)4-5-15-16(18)7-10-19(2)17(15)8-11-20(19,3)22/h6,9,13-17,21-22H,4-5,7-8,10-12H2,1-3H3/t13-,14-,15-,16+,17+,18+,19+,20-/m1/s1 |
| InChIKey | UMCBDWHORFFLCD-ULWYFIRJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| marine plankton environmental sample (ncbitaxon:632957) | endometabolome | MetaboLights (MTBLS3038) |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Epimetendiol (CHEBI:189950) has role androgen (CHEBI:50113) |
| Epimetendiol (CHEBI:189950) is a 3-hydroxy steroid (CHEBI:36834) |
| IUPAC Name |
|---|
| (3S,5R,8R,9S,10R,13S,14S,17R)-10,13,17-trimethyl-3,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-diol |
| Manual Xrefs | Databases |
|---|---|
| 52085472 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:132830-78-5 | ChemIDplus |