EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H14O12 |
| Net Charge | 0 |
| Average Mass | 362.243 |
| Monoisotopic Mass | 362.04853 |
| SMILES | O=C(O)c1c(O)cc(O)c(OC2OC(C(=O)O)C(O)C(O)C2O)c1O |
| InChI | InChI=1S/C13H14O12/c14-2-1-3(15)9(5(16)4(2)11(20)21)24-13-8(19)6(17)7(18)10(25-13)12(22)23/h1,6-8,10,13-19H,(H,20,21)(H,22,23) |
| InChIKey | QLKQBJBECIDMRS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| marine plankton environmental sample (ncbitaxon:632957) | endometabolome | MetaboLights (MTBLS3038) |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-(3-carboxy-2,4,6-trihydroxyphenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid (CHEBI:189905) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| 6-(3-carboxy-2,4,6-trihydroxyphenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0130446 | HMDB |