EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15NO6 |
| Net Charge | 0 |
| Average Mass | 269.253 |
| Monoisotopic Mass | 269.08994 |
| SMILES | COc1ccc(C(=O)NCC(=O)O)c(OC)c1OC |
| InChI | InChI=1S/C12H15NO6/c1-17-8-5-4-7(10(18-2)11(8)19-3)12(16)13-6-9(14)15/h4-5H,6H2,1-3H3,(H,13,16)(H,14,15) |
| InChIKey | WIGPKROUXMWBRT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| marine plankton environmental sample (ncbitaxon:632957) | endometabolome | MetaboLights (MTBLS3038) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-{[hydroxy(2,3,4-trimethoxyphenyl)methylidene]amino}acetic acid (CHEBI:189893) has functional parent N-benzoylglycine (CHEBI:18089) |
| 2-{[hydroxy(2,3,4-trimethoxyphenyl)methylidene]amino}acetic acid (CHEBI:189893) is a N-acylglycine (CHEBI:16180) |
| IUPAC Name |
|---|
| 2-[(2,3,4-trimethoxybenzoyl)amino]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 22752703 | ChemSpider |
| HMDB0142117 | HMDB |