EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H21NO10S2 |
| Net Charge | 0 |
| Average Mass | 439.464 |
| Monoisotopic Mass | 439.06069 |
| SMILES | O=S(=O)(O)O/N=C(\CC(O)c1ccccc1)SC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C15H21NO10S2/c17-7-10-12(19)13(20)14(21)15(25-10)27-11(16-26-28(22,23)24)6-9(18)8-4-2-1-3-5-8/h1-5,9-10,12-15,17-21H,6-7H2,(H,22,23,24)/b16-11+ |
| InChIKey | GAPDDBFHNYHZIS-LFIBNONCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| marine plankton environmental sample (ncbitaxon:632957) | endometabolome | MetaboLights (MTBLS3038) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R)-2-Hydroxy-2-phenylethyl glucosinolate (CHEBI:189879) is a alkylglucosinolate (CHEBI:36445) |
| IUPAC Name |
|---|
| [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (1E)-3-hydroxy-3-phenyl-N-sulooxypropanimidothioate |
| Manual Xrefs | Databases |
|---|---|
| 35014388 | ChemSpider |
| HMDB0037205 | HMDB |