EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15NO3 |
| Net Charge | 0 |
| Average Mass | 221.256 |
| Monoisotopic Mass | 221.10519 |
| SMILES | COC(=O)CNC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C12H15NO3/c1-16-12(15)9-13-11(14)8-7-10-5-3-2-4-6-10/h2-6H,7-9H2,1H3,(H,13,14) |
| InChIKey | AINBXHSUDDGAAY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sarcophaga peregrina (ncbitaxon:7386) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS4102) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3-Phenylpropionyl)glycine methyl ester (CHEBI:189819) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| methyl 2-(3-phenylpropanoylamino)acetate |
| Manual Xrefs | Databases |
|---|---|
| 3150006 | ChemSpider |