EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H9NO3 |
| Net Charge | 0 |
| Average Mass | 191.186 |
| Monoisotopic Mass | 191.05824 |
| SMILES | O=C(O)Cc1cccc2c1CC(=O)N2 |
| InChI | InChI=1S/C10H9NO3/c12-9-5-7-6(4-10(13)14)2-1-3-8(7)11-9/h1-3H,4-5H2,(H,11,12)(H,13,14) |
| InChIKey | QLRIVXOWYWNENI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sarcophaga peregrina (ncbitaxon:7386) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS4102) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1H-Indole-4-acetic acid, 2,3-dihydro-2-oxo- (CHEBI:189808) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| 2-(2-oxo-1,3-dihydroindol-4-yl)acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 21513239 | ChemSpider |