EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H17NO7 |
| Net Charge | 0 |
| Average Mass | 359.334 |
| Monoisotopic Mass | 359.10050 |
| SMILES | COc1cc(/C=C/C(=O)Nc2cc(OC)c(O)cc2C(=O)O)ccc1O |
| InChI | InChI=1S/C18H17NO7/c1-25-15-7-10(3-5-13(15)20)4-6-17(22)19-12-9-16(26-2)14(21)8-11(12)18(23)24/h3-9,20-21H,1-2H3,(H,19,22)(H,23,24)/b6-4+ |
| InChIKey | YDAKMIMUVCLFIN-GQCTYLIASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sarcophaga peregrina (ncbitaxon:7386) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS4102) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Avenanthramide 2 (CHEBI:189803) is a alkaloid (CHEBI:22315) |
| Avenanthramide 2 (CHEBI:189803) is a benzamides (CHEBI:22702) |
| IUPAC Name |
|---|
| 5-hydroxy-2-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]-4-methoxybenzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 30776986 | ChemSpider |
| HMDB0033211 | HMDB |