EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14N2O4S |
| Net Charge | 0 |
| Average Mass | 282.321 |
| Monoisotopic Mass | 282.06743 |
| SMILES | CNS(=O)(=O)Cc1ccc2ncc(CC(=O)O)c2c1 |
| InChI | InChI=1S/C12H14N2O4S/c1-13-19(17,18)7-8-2-3-11-10(4-8)9(6-14-11)5-12(15)16/h2-4,6,13-14H,5,7H2,1H3,(H,15,16) |
| InChIKey | HFYQCRQPYYPRAT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sarcophaga peregrina (ncbitaxon:7386) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS4102) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1H-Indole-3-acetic acid, 5-[[(methylamino)sulfonyl]methyl]- (CHEBI:189784) is a indole-3-acetic acids (CHEBI:24803) |
| IUPAC Name |
|---|
| 2-[5-(methylsulamoylmethyl)-1H-indol-3-yl]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 9953208 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:103628-44-0 | ChemIDplus |