EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14N2O6 |
| Net Charge | 0 |
| Average Mass | 246.219 |
| Monoisotopic Mass | 246.08519 |
| SMILES | N[C@@H](CC(=O)O)C(=O)N1C[C@H](O)C[C@H]1C(=O)O |
| InChI | InChI=1S/C9H14N2O6/c10-5(2-7(13)14)8(15)11-3-4(12)1-6(11)9(16)17/h4-6,12H,1-3,10H2,(H,13,14)(H,16,17)/t4-,5+,6+/m1/s1 |
| InChIKey | WJDUWENBTQEKDZ-SRQIZXRXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sarcophaga peregrina (ncbitaxon:7386) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS4102) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aspartyl-Hydroxyproline (CHEBI:189770) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S,4R)-1-[(2S)-2-amino-3-carboxypropanoyl]-4-hydroxypyrrolidine-2-carboxylic acid |