EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H9NO5 |
| Net Charge | 0 |
| Average Mass | 223.184 |
| Monoisotopic Mass | 223.04807 |
| SMILES | O=C(O)CNC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H9NO5/c12-9(13)4-11-10(14)6-1-2-7-8(3-6)16-5-15-7/h1-3H,4-5H2,(H,11,14)(H,12,13) |
| InChIKey | FWHKWFNOFSQUIU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sarcophaga peregrina (ncbitaxon:7386) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS4102) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-{[(2H-1,3-benzodioxol-5-yl)(hydroxy)methylidene]amino}acetic acid (CHEBI:189769) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| 2-(1,3-benzodioxole-5-carbonylamino)acetic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0129380 | HMDB |
| 1742100 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:27855-25-0 | ChemIDplus |