EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H28O2 |
| Net Charge | 0 |
| Average Mass | 252.398 |
| Monoisotopic Mass | 252.20893 |
| SMILES | CCCCCCCCC#CCCCCCC(=O)O |
| InChI | InChI=1S/C16H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-8,11-15H2,1H3,(H,17,18) |
| InChIKey | XNLVWARRDCVUBL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sarcophaga peregrina (ncbitaxon:7386) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS4102) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-hexadecynoic acid (CHEBI:189765) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| hexadec-7-ynoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4472058 | ChemSpider |
| LMFA01030496 | LIPID MAPS |