EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H39NO6 |
| Net Charge | 0 |
| Average Mass | 401.544 |
| Monoisotopic Mass | 401.27774 |
| SMILES | CCCCCCC(=O)CCCCCC/C=C/[C@H](O)[C@@H](O)[C@H](O)[C@](C)(N)C(=O)O |
| InChI | InChI=1S/C21H39NO6/c1-3-4-5-10-13-16(23)14-11-8-6-7-9-12-15-17(24)18(25)19(26)21(2,22)20(27)28/h12,15,17-19,24-26H,3-11,13-14,22H2,1-2H3,(H,27,28)/b15-12+/t17-,18+,19-,21-/m0/s1 |
| InChIKey | KEACSJIKRANUJC-NZBAJYJFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paecilomyces variotii (ncbitaxon:264951) | - | PubMed (1474000) | |
| Sarcophaga peregrina (ncbitaxon:7386) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS4102) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sphingofungin F (CHEBI:189760) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Names |
|---|
| (E)-2-amino-3,4,5-trihydroxy-2-methyl-14-oxoicos-6-enoic acid |
| (E,2S,3R,4R,5S)-2-amino-3,4,5-trihydroxy-2-methyl-14-oxoicos-6-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4943886 | ChemSpider |
| 9113495 | ChemSpider |
| LMSP01080066 | LIPID MAPS |