EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12O4 |
| Net Charge | 0 |
| Average Mass | 196.202 |
| Monoisotopic Mass | 196.07356 |
| SMILES | COc1ccc(CCC(=O)O)cc1O |
| InChI | InChI=1S/C10H12O4/c1-14-9-4-2-7(6-8(9)11)3-5-10(12)13/h2,4,6,11H,3,5H2,1H3,(H,12,13) |
| InChIKey | ZVIJTQFTLXXGJA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydroisoferulic acid (CHEBI:189726) is a benzenes (CHEBI:22712) |
| dihydroisoferulic acid (CHEBI:189726) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 3-(3-hydroxy-4-methoxyphenyl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 2033192 | ChemSpider |
| HMDB0131138 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:1135-15-5 | ChemIDplus |