EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18O10 |
| Net Charge | 0 |
| Average Mass | 370.310 |
| Monoisotopic Mass | 370.09000 |
| SMILES | COc1cc(/C=C/C(=O)O)ccc1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H18O10/c1-24-9-6-7(3-5-10(17)18)2-4-8(9)25-16-13(21)11(19)12(20)14(26-16)15(22)23/h2-6,11-14,16,19-21H,1H3,(H,17,18)(H,22,23)/b5-3+/t11-,12-,13+,14-,16+/m0/s1 |
| InChIKey | TWSIWBHKRJLZCF-MBAOVNHDSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ferulic acid 4-glucuronide (CHEBI:189724) is a glycoside (CHEBI:24400) |
| ferulic acid 4-glucuronide (CHEBI:189724) is conjugate acid of (E)-4-O-(β-D-glucuronosyl)-ferulate(2−) (CHEBI:231331) |
| Incoming Relation(s) |
| (E)-4-O-(β-D-glucuronosyl)-ferulate(2−) (CHEBI:231331) is conjugate base of ferulic acid 4-glucuronide (CHEBI:189724) |
| IUPAC Name |
|---|
| (2S,3S,4S,5R,6S)-6-[4-[(E)-2-carboxyethenyl]-2-methoxyphenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 4947174 | ChemSpider |
| HMDB0041733 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:86321-24-6 | ChemIDplus |