EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H7NO4 |
| Net Charge | 0 |
| Average Mass | 157.125 |
| Monoisotopic Mass | 157.03751 |
| SMILES | N/C(=C/C=C\C(=O)O)C(=O)O |
| InChI | InChI=1S/C6H7NO4/c7-4(6(10)11)2-1-3-5(8)9/h1-3H,7H2,(H,8,9)(H,10,11)/b3-1-,4-2+ |
| InChIKey | ZRHONLCTYUYMIQ-HSFFGMMNSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E,4Z)-2-aminomuconic acid (CHEBI:189698) is a 2-aminomuconic acid (CHEBI:16886) |
| IUPAC Name |
|---|
| (2E,4Z)-2-aminohexa-2,4-dienedioic acid |
| Synonyms | Source |
|---|---|
| trans,cis-2-aminomuconic acid | ChEBI |
| (2E,4Z)-2-amino-2,4-hexadienedioic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 4444139 | ChemSpider |
| LMFA01170082 | LIPID MAPS |