EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H81NO9 |
| Net Charge | 0 |
| Average Mass | 756.119 |
| Monoisotopic Mass | 755.59113 |
| SMILES | CCCCCCCCCCCCCCCCC(O)C(=O)N[C@@H](CO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)[C@H](O)/C=C/CC/C=C(\C)CCCCCCCCC |
| InChI | InChI=1S/C43H81NO9/c1-4-6-8-10-12-13-14-15-16-17-18-20-22-26-31-37(47)42(51)44-35(33-52-43-41(50)40(49)39(48)38(32-45)53-43)36(46)30-27-23-25-29-34(3)28-24-21-19-11-9-7-5-2/h27,29-30,35-41,43,45-50H,4-26,28,31-33H2,1-3H3,(H,44,51)/b30-27+,34-29+/t35-,36+,37?,38+,39+,40-,41+,43+/m0/s1 |
| InChIKey | RIZIAUKTHDLMQX-FEQQMLCXSA-N |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cerebroside D (CHEBI:189692) has role fungal metabolite (CHEBI:76946) |
| cerebroside D (CHEBI:189692) is a glycosylceramide (CHEBI:62941) |
| IUPAC Name |
|---|
| N-(2-hydroxy-octadecanoyl)-1-beta-glucosyl-9-methyl-sphinga-4E,8E-dienine |
| Manual Xrefs | Databases |
|---|---|
| C00044623 | KNApSAcK |
| LMSP05010135 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:113773-89-0 | KNApSAcK |
| Citations |
|---|