EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17N3O5S |
| Net Charge | 0 |
| Average Mass | 363.395 |
| Monoisotopic Mass | 363.08889 |
| SMILES | CNC(=O)Nc1ccc(S(=O)(=O)NC(=O)c2ccccc2OC)cc1 |
| InChI | InChI=1S/C16H17N3O5S/c1-17-16(21)18-11-7-9-12(10-8-11)25(22,23)19-15(20)13-5-3-4-6-14(13)24-2/h3-10H,1-2H3,(H,19,20)(H2,17,18,21) |
| InChIKey | JCHMGYRXQDASJE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | herbicide safener A compound used with herbicides that reduces the effect of the herbicide on crop plants or otherwise improves the selectivity of the herbicide for weed species over the crop plant. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metcamifen (CHEBI:189672) has role herbicide safener (CHEBI:132272) |
| metcamifen (CHEBI:189672) is a N-sulfonylcarboxamide (CHEBI:90852) |
| metcamifen (CHEBI:189672) is a benzamides (CHEBI:22702) |
| metcamifen (CHEBI:189672) is a monomethoxybenzene (CHEBI:25235) |
| metcamifen (CHEBI:189672) is a sulfonamide (CHEBI:35358) |
| metcamifen (CHEBI:189672) is a ureas (CHEBI:47857) |
| IUPAC Name |
|---|
| 2-methoxy-N-({4-[(methylcarbamoyl)amino]phenyl}sulfonyl)benzamide |
| Synonyms | Source |
|---|---|
| 2-methoxy-N-[[4-[[(methylamino)carbonyl]amino]phenyl]sulfonyl]benzamide | Alan Wood's Pesticides |
| 2-methoxy-N-{4-[(methylcarbamoyl)amino](benzene-1-sulfonyl)}benzamide | Alan Wood's Pesticides |
| 2-methoxy-N-{4-[(methylcarbamoyl)amino]benzene-1-sulfonyl}benzamide | IUPAC |
| N-{[4-(3-methylureido)phenyl]sulfonyl}-o-anisamide | Alan Wood's Pesticides |
| Brand Name | Source |
|---|---|
| EPIVIO C Sorghum Seed Safener | PPDB |
| Manual Xrefs | Databases |
|---|---|
| 3300 | PPDB |
| 9734375 | ChemSpider |
| metcamifen | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11738324 | Reaxys |
| CAS:129531-12-0 | Alan Wood's Pesticides |
| Citations |
|---|