EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12ClN3O2 |
| Net Charge | 0 |
| Average Mass | 289.722 |
| Monoisotopic Mass | 289.06180 |
| SMILES | [H][C@@]1(c2nc(=O)c3oc4ccc(Cl)cc4c3n2)CCCN1 |
| InChI | InChI=1S/C14H12ClN3O2/c15-7-3-4-10-8(6-7)11-12(20-10)14(19)18-13(17-11)9-2-1-5-16-9/h3-4,6,9,16H,1-2,5H2,(H,17,18,19)/t9-/m0/s1 |
| InChIKey | JJWLXRKVUJDJKG-VIFPVBQESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of non-specific serine/threonine protein kinase (EC 2.7.11.1), a kinase enzyme involved in phosphorylation of hydroxy group of serine or threonine. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| XL413 (CHEBI:189662) has role antineoplastic agent (CHEBI:35610) |
| XL413 (CHEBI:189662) has role EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor (CHEBI:50925) |
| XL413 (CHEBI:189662) is a benzofuropyrimidine (CHEBI:189664) |
| XL413 (CHEBI:189662) is a organochlorine compound (CHEBI:36683) |
| XL413 (CHEBI:189662) is a pyrrolidines (CHEBI:38260) |
| IUPAC Name |
|---|
| 8-chloro-2-[(2S)-pyrrolidin-2-yl][1]benzofuro[3,2-d]pyrimidin-4(3H)-one |
| Synonyms | Source |
|---|---|
| BMS 863233 | ChEBI |
| BMS-863233 | ChemIDplus |
| BMS863233 | ChEBI |
| XL 413 | ChEBI |
| XL-413 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:1169558-38-6 | ChemIDplus |
| Citations |
|---|