EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H20ClN7O |
| Net Charge | 0 |
| Average Mass | 433.903 |
| Monoisotopic Mass | 433.14179 |
| SMILES | O=C(c1ccc(-n2nnc3cccnc32)cc1)N(c1ncccc1Cl)[C@@H]1CCCNC1 |
| InChI | InChI=1S/C22H20ClN7O/c23-18-5-2-12-25-20(18)29(17-4-1-11-24-14-17)22(31)15-7-9-16(10-8-15)30-21-19(27-28-30)6-3-13-26-21/h2-3,5-10,12-13,17,24H,1,4,11,14H2/t17-/m1/s1 |
| InChIKey | FDTXHWQFIXYHCL-QGZVFWFLSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.4.21.61 (kexin) inhibitor An EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of kexin (EC 3.4.21.61). |
| Application: | antilipemic drug A substance used to treat hyperlipidemia (an excess of lipids in the blood). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PF-06446846 (CHEBI:189659) has role antilipemic drug (CHEBI:35679) |
| PF-06446846 (CHEBI:189659) has role EC 3.4.21.61 (kexin) inhibitor (CHEBI:189665) |
| PF-06446846 (CHEBI:189659) is a benzamides (CHEBI:22702) |
| PF-06446846 (CHEBI:189659) is a monochloropyridine (CHEBI:39172) |
| PF-06446846 (CHEBI:189659) is a piperidines (CHEBI:26151) |
| PF-06446846 (CHEBI:189659) is a tertiary carboxamide (CHEBI:140326) |
| PF-06446846 (CHEBI:189659) is a triazolopyridine (CHEBI:46746) |
| IUPAC Name |
|---|
| N-(3-chloropyridin-2-yl)-N-[(3R)-piperidin-3-yl]-4-(3H-[1,2,3]triazolo[4,5-b]pyridin-3-yl)benzamide |
| Synonyms | Source |
|---|---|
| PF 06446846 | ChEBI |
| PF-06446846 | ChEBI |
| PF06446846 | ChEBI |
| PF-846 | ChEBI |
| Citations |
|---|