EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H12Cl2N4O4S |
| Net Charge | 0 |
| Average Mass | 451.291 |
| Monoisotopic Mass | 449.99563 |
| SMILES | O=C(O)C(Cc1ccccc1[N+](=O)[O-])=NNc1nc(-c2ccc(Cl)c(Cl)c2)cs1 |
| InChI | InChI=1S/C18H12Cl2N4O4S/c19-12-6-5-10(7-13(12)20)15-9-29-18(21-15)23-22-14(17(25)26)8-11-3-1-2-4-16(11)24(27)28/h1-7,9H,8H2,(H,21,23)(H,25,26) |
| InChIKey | KFRKRECSIYXARE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4EGI-1 (CHEBI:189658) is a C-nitro compound (CHEBI:35716) |
| 4EGI-1 (CHEBI:189658) is a 1,3-thiazoles (CHEBI:38418) |
| 4EGI-1 (CHEBI:189658) is a dichlorobenzene (CHEBI:23697) |
| 4EGI-1 (CHEBI:189658) is a hydrazone (CHEBI:38532) |
| 4EGI-1 (CHEBI:189658) is a monocarboxylic acid (CHEBI:25384) |
| Manual Xrefs | Databases |
|---|---|
| 4EGI-1 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:315706-13-9 | ChEBI |
| Citations |
|---|