EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H16ClN3O2 |
| Net Charge | 0 |
| Average Mass | 365.820 |
| Monoisotopic Mass | 365.09310 |
| SMILES | Cc1noc2c1-c1ccccc1C(c1ccc(Cl)cc1)=N[C@H]2CC(N)=O |
| InChI | InChI=1S/C20H16ClN3O2/c1-11-18-14-4-2-3-5-15(14)19(12-6-8-13(21)9-7-12)23-16(10-17(22)25)20(18)26-24-11/h2-9,16H,10H2,1H3,(H2,22,25)/t16-/m0/s1 |
| InChIKey | GCWIQUVXWZWCLE-INIZCTEOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | bromodomain-containing protein 4 inhibitor Any inhibitor of bromodomain-containing protein 4 (BRD4). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pelabresib (CHEBI:189653) has role antineoplastic agent (CHEBI:35610) |
| pelabresib (CHEBI:189653) has role bromodomain-containing protein 4 inhibitor (CHEBI:137114) |
| pelabresib (CHEBI:189653) is a monochlorobenzenes (CHEBI:83403) |
| pelabresib (CHEBI:189653) is a organic heterotricyclic compound (CHEBI:26979) |
| pelabresib (CHEBI:189653) is a primary carboxamide (CHEBI:140324) |
| IUPAC Name |
|---|
| 2-[(4S)-6-(4-chlorophenyl)-1-methyl-4H-[1,2]oxazolo[5,4-d][2]benzazepin-4-yl]acetamide |
| INNs | Source |
|---|---|
| pelabresib | WHO MedNet |
| pelabresib | WHO MedNet |
| pélabrésib | WHO MedNet |
| pelabresibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2-((4S)-6-(4-chlorophenyl)-1-methyl-4H-isoxazolo[5,4-d][2]benzazepin-4-yl)acetamide | ChemIDplus |
| CPI 0610 | ChEBI |
| CPI-0610 | ChEBI |
| CPI0610 | ChEBI |
| CPI-0610 anhydrous | ChEBI |
| CPI-232 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:1380087-89-7 | ChemIDplus |
| Citations |
|---|