EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H38N2O |
| Net Charge | 0 |
| Average Mass | 370.581 |
| Monoisotopic Mass | 370.29841 |
| SMILES | COc1cccc2c1CCCC2CCCN1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C24H38N2O/c1-27-24-14-6-12-22-20(8-5-13-23(22)24)9-7-15-25-16-18-26(19-17-25)21-10-3-2-4-11-21/h6,12,14,20-21H,2-5,7-11,13,15-19H2,1H3 |
| InChIKey | PHRCDWVPTULQMT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| Applications: | sigma-2 receptor agonist A sigma receptor modulator that activates the sigma-2 receptor. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PB28 (CHEBI:189648) has role anticoronaviral agent (CHEBI:149553) |
| PB28 (CHEBI:189648) has role antineoplastic agent (CHEBI:35610) |
| PB28 (CHEBI:189648) has role apoptosis inducer (CHEBI:68495) |
| PB28 (CHEBI:189648) has role sigma-2 receptor agonist (CHEBI:189684) |
| PB28 (CHEBI:189648) is a aromatic ether (CHEBI:35618) |
| PB28 (CHEBI:189648) is a piperazines (CHEBI:26144) |
| PB28 (CHEBI:189648) is a tetralins (CHEBI:36786) |
| IUPAC Name |
|---|
| 1-cyclohexyl-4-[3-(5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)propyl]piperazine |
| Synonyms | Source |
|---|---|
| 1-(3-(5-methoxytetralin-1-yl)propyl)-4-cyclohexylpiperazine | ChEBI |
| 1-cyclohexyl-4-[3-(1,2,3,4-tetrahydro-5-methoxy-1-naphthalenyl)propyl]piperazine | ChEBI |
| 1-cyclohexyl-4-[3-(5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)-n-propyl]piperazine | ChEBI |
| PB 28 | ChEBI |
| PB-28 | ChEBI |
| Citations |
|---|