EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O3 |
| Net Charge | 0 |
| Average Mass | 166.176 |
| Monoisotopic Mass | 166.06299 |
| SMILES | CCOC(=O)/C=C/c1ccco1 |
| InChI | InChI=1S/C9H10O3/c1-2-11-9(10)6-5-8-4-3-7-12-8/h3-7H,2H2,1H3/b6-5+ |
| InChIKey | MWZBTMXISMOMAE-AATRIKPKSA-N |
| Roles Classification |
|---|
| Biological Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-ethyl 3-(2-furyl)acrylate (CHEBI:189588) has role flavouring agent (CHEBI:35617) |
| (E)-ethyl 3-(2-furyl)acrylate (CHEBI:189588) is a ethyl 3-(2-furyl)acrylate (CHEBI:173754) |
| IUPAC Name |
|---|
| ethyl (2E)-3-(furan-2-yl)prop-2-enoate |
| Synonyms | Source |
|---|---|
| FEMA 4541 | ChEBI |
| (2E)-ethyl 3-(2-furyl)acrylate | ChemIDplus |
| (E)-ethyl 3-(2-furyl)-2-propenoate | ChemIDplus |
| (E)-ethyl 3-furan-2-ylacrylate | ChemIDplus |
| ethyl trans-2-furanacrylate | ChemIDplus |
| (E)-ethyl 3-(furan-2-yl)prop-2-enoate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 21407691 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:82116 | Reaxys |
| CAS:53282-12-5 | ChemIDplus |
| CAS:53282-12-5 | NIST Chemistry WebBook |