EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12O6 |
| Net Charge | 0 |
| Average Mass | 240.211 |
| Monoisotopic Mass | 240.06339 |
| SMILES | COc1c(O)cc2c(c1O)C(=O)O[C@H](C)[C@H]2O |
| InChI | InChI=1S/C11H12O6/c1-4-8(13)5-3-6(12)10(16-2)9(14)7(5)11(15)17-4/h3-4,8,12-14H,1-2H3/t4-,8-/m1/s1 |
| InChIKey | ZLLQQKITWRWKTD-SPGJFGJESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryza sativa (ncbitaxon:4530) | leaf sheath (BTO:0005094) | MetaboLights (MTBLS3518) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3r,4s)-4,6,8-trihydroxy-7-methoxy-3-methyl-3,4-dihydro-1h-isochromen-1-one (CHEBI:189520) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| (3R,4S)-4,6,8-trihydroxy-7-methoxy-3-methyl-3,4-dihydroisochromen-1-one |
| Manual Xrefs | Databases |
|---|---|
| 29814443 | ChemSpider |