EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H25N3O3S |
| Net Charge | 0 |
| Average Mass | 363.483 |
| Monoisotopic Mass | 363.16166 |
| SMILES | COCc1cc(C[C@H]2CNCC[C@H]2CC(=O)NCc2cccs2)no1 |
| InChI | InChI=1S/C18H25N3O3S/c1-23-12-16-9-15(21-24-16)7-14-10-19-5-4-13(14)8-18(22)20-11-17-3-2-6-25-17/h2-3,6,9,13-14,19H,4-5,7-8,10-12H2,1H3,(H,20,22)/t13-,14-/m0/s1 |
| InChIKey | FDPBCCKTWVYUJL-KBPBESRZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryza sativa (ncbitaxon:4530) | leaf sheath (BTO:0005094) | MetaboLights (MTBLS3518) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[(3r,4s)-3-{[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl}-4-piperidinyl]-n-(2-thienylmethyl)acetamide (CHEBI:189484) is a aralkylamine (CHEBI:18000) |
| IUPAC Name |
|---|
| 2-[(3R,4S)-3-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl]piperidin-4-yl]-N-(thiophen-2-ylmethyl)acetamide |
| Manual Xrefs | Databases |
|---|---|
| 21384830 | ChemSpider |