EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H32N4O2S |
| Net Charge | 0 |
| Average Mass | 404.580 |
| Monoisotopic Mass | 404.22460 |
| SMILES | [H][C@@]12CCN(C[C@@H]1CN1CCSCC1)[C@@H](CNC(=O)Nc1ccc(OC)cc1)C2 |
| InChI | InChI=1S/C21H32N4O2S/c1-27-20-4-2-18(3-5-20)23-21(26)22-13-19-12-16-6-7-25(19)15-17(16)14-24-8-10-28-11-9-24/h2-5,16-17,19H,6-15H2,1H3,(H2,22,23,26)/t16-,17-,19+/m0/s1 |
| InChIKey | BFLCAQIGNXZBBA-JENIJYKNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryza sativa (ncbitaxon:4530) | leaf sheath (BTO:0005094) | MetaboLights (MTBLS3518) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(4-methoxyphenyl)-3-{[(2r,4s,5s)-5-(4-thiomorpholinylmethyl)-1-azabicyclo[2.2.2]oct-2-yl]methyl}urea (CHEBI:189470) is a methoxybenzenes (CHEBI:51683) |
| 1-(4-methoxyphenyl)-3-{[(2r,4s,5s)-5-(4-thiomorpholinylmethyl)-1-azabicyclo[2.2.2]oct-2-yl]methyl}urea (CHEBI:189470) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 1-(4-methoxyphenyl)-3-[[(2R,4S,5S)-5-(thiomorpholin-4-ylmethyl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]urea |
| Manual Xrefs | Databases |
|---|---|
| 21382098 | ChemSpider |