EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22O12 |
| Net Charge | 0 |
| Average Mass | 478.406 |
| Monoisotopic Mass | 478.11113 |
| SMILES | O=C(/C=C/c1ccc(O)cc1)OCC1OC(OC(=O)c2cc(O)c(O)c(O)c2)C(O)C(O)C1O |
| InChI | InChI=1S/C22H22O12/c23-12-4-1-10(2-5-12)3-6-16(26)32-9-15-18(28)19(29)20(30)22(33-15)34-21(31)11-7-13(24)17(27)14(25)8-11/h1-8,15,18-20,22-25,27-30H,9H2/b6-3+ |
| InChIKey | LWOXGQKLDYQLMZ-ZZXKWVIFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryza sativa (ncbitaxon:4530) | leaf sheath (BTO:0005094) | MetaboLights (MTBLS3518) |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-o-[(2e)-3-(4-hydroxyphenyl)-2-propenoyl]-1-o-(3,4,5-trihydroxybenzoyl)hexopyranose (CHEBI:189461) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| [3,4,5-trihydroxy-6-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxymethyl]oxan-2-yl] 3,4,5-trihydroxybenzoate |
| Manual Xrefs | Databases |
|---|---|
| 22913500 | ChemSpider |