EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H32O3 |
| Net Charge | 0 |
| Average Mass | 296.451 |
| Monoisotopic Mass | 296.23514 |
| SMILES | CCCCC/C=C\C[C@H]1O[C@H]1CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H32O3/c1-2-3-4-5-7-10-13-16-17(21-16)14-11-8-6-9-12-15-18(19)20/h7,10,16-17H,2-6,8-9,11-15H2,1H3,(H,19,20)/b10-7-/t16-,17+/m1/s1 |
| InChIKey | FBUKMFOXMZRGRB-XKJZPFPASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryza sativa (ncbitaxon:4530) | leaf sheath (BTO:0005094) | MetaboLights (MTBLS3518) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+/-)9(10)-epome (CHEBI:189454) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| 8-[(2S,3R)-3-[(Z)-oct-2-enyl]oxiran-2-yl]octanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 29341383 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:61949-82-4 | ChemIDplus |