EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H7O3.Na |
| Net Charge | 0 |
| Average Mass | 138.098 |
| Monoisotopic Mass | 138.02929 |
| SMILES | CC(C)C(=O)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C5H8O3.Na/c1-3(2)4(6)5(7)8;/h3H,1-2H3,(H,7,8);/q;+1/p-1 |
| InChIKey | WIQBZDCJCRFGKA-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | guard cell (BTO:0000544) | MetaboLights (MTBLS1326) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sodium-3-methyl-2-oxobutyrate (CHEBI:189431) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| sodium;3-methyl-2-oxobutanoate |