EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O4 |
| Net Charge | 0 |
| Average Mass | 194.186 |
| Monoisotopic Mass | 194.05791 |
| SMILES | COc1ccc(C=CC(=O)O)cc1O |
| InChI | InChI=1S/C10H10O4/c1-14-9-4-2-7(6-8(9)11)3-5-10(12)13/h2-6,11H,1H3,(H,12,13) |
| InChIKey | QURCVMIEKCOAJU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | guard cell (BTO:0000544) | MetaboLights (MTBLS1326) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-Hydroxy 4-Methoxy Cinnamic acid (CHEBI:189424) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| 3-(3-hydroxy-4-methoxyphenyl)prop-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 83172 | ChemSpider |
| D78092 | KEGG DRUG |
| HMDB0131137 | HMDB |