EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H15NO3 |
| Net Charge | 0 |
| Average Mass | 329.355 |
| Monoisotopic Mass | 329.10519 |
| SMILES | O=C(O)c1ccccc1C(=O)Nc1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C21H15NO3/c23-20(18-7-3-4-8-19(18)21(24)25)22-15-9-10-17-14(12-15)11-13-5-1-2-6-16(13)17/h1-10,12H,11H2,(H,22,23)(H,24,25) |
| InChIKey | QUJRZEAMTDWGDV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-2-fluorenylphthalamic acid (CHEBI:189414) has role carcinogenic agent (CHEBI:50903) |
| N-2-fluorenylphthalamic acid (CHEBI:189414) is a benzamides (CHEBI:22702) |
| N-2-fluorenylphthalamic acid (CHEBI:189414) is a benzoic acids (CHEBI:22723) |
| N-2-fluorenylphthalamic acid (CHEBI:189414) is a dicarboxylic acid monoamide (CHEBI:35735) |
| N-2-fluorenylphthalamic acid (CHEBI:189414) is a fluorenes (CHEBI:24059) |
| N-2-fluorenylphthalamic acid (CHEBI:189414) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| 2-(9H-fluoren-2-ylcarbamoyl)benzoic acid |
| Synonyms | Source |
|---|---|
| 2-benzoylamidofluorene-2'-carboxylic acid | ChemIDplus |
| 2-benzoylaminofluorene-2'-carboxylic acid | ChemIDplus |
| 2-FPA | ChEBI |
| N-(2-fluorenyl)phthalamic acid | ChemIDplus |
| N-fluoren-2-ylphthalamic acid | ChemIDplus |
| N-fluorenyl-2-phthalimic acid | ChemIDplus |
| Citations |
|---|