EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12FNO |
| Net Charge | 0 |
| Average Mass | 229.254 |
| Monoisotopic Mass | 229.09029 |
| SMILES | CC(=O)Nc1ccc(-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C14H12FNO/c1-10(17)16-14-8-4-12(5-9-14)11-2-6-13(15)7-3-11/h2-9H,1H3,(H,16,17) |
| InChIKey | JORMZLCKCZMVJM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4'-(4-fluorophenyl)acetanilide (CHEBI:189411) has role carcinogenic agent (CHEBI:50903) |
| 4'-(4-fluorophenyl)acetanilide (CHEBI:189411) is a N-acetylarylamine (CHEBI:13790) |
| 4'-(4-fluorophenyl)acetanilide (CHEBI:189411) is a biphenyls (CHEBI:22888) |
| 4'-(4-fluorophenyl)acetanilide (CHEBI:189411) is a monofluorobenzenes (CHEBI:83575) |
| 4'-(4-fluorophenyl)acetanilide (CHEBI:189411) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| N-(4'-fluoro[biphenyl]-4-yl)acetamide |
| Synonyms | Source |
|---|---|
| 4'-(4-fluorophenyl)acetanilide | ChEBI |
| 4-acetylamino-4'-fluorobiphenyl | ChEBI |
| 4'-(p-fluorophenyl)acetanilide | ChemIDplus |
| 4'-fluoro-4-acetylaminobiphenyl | ChemIDplus |
| 4'-fluoro-4-biphenylacetamide | ChemIDplus |
| N-4-(4'-fluoro)biphenylacetamide | ChemIDplus |
| Citations |
|---|