EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O |
| Net Charge | 0 |
| Average Mass | 426.729 |
| Monoisotopic Mass | 426.38617 |
| SMILES | C=C1CC[C@H](O)C(C)(C)[C@@H]1CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C30H50O/c1-23(2)13-11-16-25(4)18-12-17-24(3)14-9-10-15-26(5)19-21-28-27(6)20-22-29(31)30(28,7)8/h13-15,18,28-29,31H,6,9-12,16-17,19-22H2,1-5,7-8H3/b24-14+,25-18+,26-15+/t28-,29+/m1/s1 |
| InChIKey | ANKPMKKGZZQDIC-HJSIMFEZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Achillea odorata (IPNI:174152-1) | - | DOI (10.1016/S0040-4039(02)00358-1) | |
| Camellia sasanqua (ncbitaxon:182300) | - | PubMed (10075756) | |
| Maclura tricuspidata (ncbitaxon:210328) | Root (BTO:0001188) | PubMed (27420919) | Species also known as Cudrania tricuspidata. Isolated from root bark. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| achilleol A (CHEBI:189410) has role plant metabolite (CHEBI:76924) |
| achilleol A (CHEBI:189410) is a monocyclic compound (CHEBI:33661) |
| achilleol A (CHEBI:189410) is a olefinic compound (CHEBI:78840) |
| achilleol A (CHEBI:189410) is a secondary alcohol (CHEBI:35681) |
| achilleol A (CHEBI:189410) is a triterpenoid (CHEBI:36615) |
| IUPAC Name |
|---|
| (1S,3R)-2,2-dimethyl-4-methylidene-3-[(3E,7E,11E)-3,8,12,16-tetramethylheptadeca-3,7,11,15-tetraen-1-yl]cyclohexanol |
| Synonym | Source |
|---|---|
| (−)-achilleol A | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:125287-06-1 | ChemIDplus |
| Citations |
|---|