EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14O |
| Net Charge | 0 |
| Average Mass | 126.199 |
| Monoisotopic Mass | 126.10447 |
| SMILES | [H]C(=O)/C(=C\CCC)CC |
| InChI | InChI=1S/C8H14O/c1-3-5-6-8(4-2)7-9/h6-7H,3-5H2,1-2H3/b8-6- |
| InChIKey | PYLMCYQHBRSDND-VURMDHGXSA-N |
| Roles Classification |
|---|
| Biological Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Z)-2-ethyl-2-hexenal (CHEBI:189407) is a 2-ethyl-2-hexenal (CHEBI:88838) |
| IUPAC Name |
|---|
| (2Z)-2-ethylhex-2-enal |
| Synonyms | Source |
|---|---|
| (Z)-2-ethyl-3-propylacrolein | ChemIDplus |
| cis-2-ethyl-2-hexenal | ChemIDplus |
| (2Z)-2-ethyl-2-hexenal | ChemIDplus |
| (Z)-2-ethylhex-2-enal | ChEBI |
| cis-2-ethylhex-2-enal | ChEBI |
| (2Z)-2-ethyl-3-propylacrolein | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2037341 | Reaxys |
| CAS:88288-45-3 | ChemIDplus |