EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H15N2O5 |
| Net Charge | -1 |
| Average Mass | 231.228 |
| Monoisotopic Mass | 231.09865 |
| SMILES | CC[C@H](NC(=O)CC[C@H]([NH3+])C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C9H16N2O5/c1-2-6(9(15)16)11-7(12)4-3-5(10)8(13)14/h5-6H,2-4,10H2,1H3,(H,11,12)(H,13,14)(H,15,16)/p-1/t5-,6-/m0/s1 |
| InChIKey | FUZOZPRKGAXGOB-WDSKDSINSA-M |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-L-glutamyl-(2S)-2-aminobutanoate (CHEBI:189406) is a dipeptide (CHEBI:46761) |
| γ-L-glutamyl-(2S)-2-aminobutanoate (CHEBI:189406) is conjugate base of gamma-L-Glutamyl-L-2-aminobutyrate (CHEBI:176875) |
| Incoming Relation(s) |
| gamma-L-Glutamyl-L-2-aminobutyrate (CHEBI:176875) is conjugate acid of γ-L-glutamyl-(2S)-2-aminobutanoate (CHEBI:189406) |
| UniProt Name | Source |
|---|---|
| γ-L-glutamyl-(2S)-2-aminobutanoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-22077 | MetaCyc |