EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14O |
| Net Charge | 0 |
| Average Mass | 126.199 |
| Monoisotopic Mass | 126.10447 |
| SMILES | [H]C(=O)/C(=C/CCC)CC |
| InChI | InChI=1S/C8H14O/c1-3-5-6-8(4-2)7-9/h6-7H,3-5H2,1-2H3/b8-6+ |
| InChIKey | PYLMCYQHBRSDND-SOFGYWHQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Camponotus irritibilis (ncbitaxon:13390) | - | PubMed (18213494) |
| Roles Classification |
|---|
| Chemical Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-2-ethyl-2-hexenal (CHEBI:189405) has role animal metabolite (CHEBI:75767) |
| (E)-2-ethyl-2-hexenal (CHEBI:189405) is a 2-ethyl-2-hexenal (CHEBI:88838) |
| IUPAC Name |
|---|
| (2E)-2-ethylhex-2-enal |
| Synonyms | Source |
|---|---|
| (2E)-2-ethyl-2-hexenal | ChemIDplus |
| (2E)-2-ethyl-3-propylacrolein | ChEBI |
| (E)-2-ethyl-3-propylacrolein | ChEBI |
| (E)-2-ethylhex-2-enal | ChEBI |
| (E)-2-ethylhexenal | ChEBI |
| trans-2-ethyl-2-hexenal | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4510484 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1700153 | Reaxys |
| CAS:64344-45-2 | ChemIDplus |
| Citations |
|---|