EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H37N3O3 |
| Net Charge | 0 |
| Average Mass | 475.633 |
| Monoisotopic Mass | 475.28349 |
| SMILES | CCC1CN2CCc3cc(OC)c(OC)cc3C2CC1CC1NCCc2c1nc1ccc(O)cc21 |
| InChI | InChI=1S/C29H37N3O3/c1-4-17-16-32-10-8-18-13-27(34-2)28(35-3)15-22(18)26(32)12-19(17)11-25-29-21(7-9-30-25)23-14-20(33)5-6-24(23)31-29/h5-6,13-15,17,19,25-26,30-31,33H,4,7-12,16H2,1-3H3 |
| InChIKey | JRVWIILYWSBUMC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | leaf (BTO:0000713) | MetaboLights (MTBLS3997) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| TCMDC-138263 (CHEBI:189396) is a harmala alkaloid (CHEBI:61379) |
| IUPAC Name |
|---|
| 1-[(3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl)methyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-6-ol |
| Manual Xrefs | Databases |
|---|---|
| 525582 | ChemSpider |