EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8N2O2S |
| Net Charge | 0 |
| Average Mass | 196.231 |
| Monoisotopic Mass | 196.03065 |
| SMILES | COC(=O)c1sc(N)c(C#N)c1C |
| InChI | InChI=1S/C8H8N2O2S/c1-4-5(3-9)7(10)13-6(4)8(11)12-2/h10H2,1-2H3 |
| InChIKey | PDDIXJQTRLVRCG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | leaf (BTO:0000713) | MetaboLights (MTBLS3997) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-Amino-3-Cyano-4-Methyl-5-Carbmethoxy Thiophene (CHEBI:189395) is a aromatic amine (CHEBI:33860) |
| 2-Amino-3-Cyano-4-Methyl-5-Carbmethoxy Thiophene (CHEBI:189395) is a thiophenes (CHEBI:26961) |
| IUPAC Name |
|---|
| methyl 5-amino-4-cyano-3-methylthiophene-2-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 518878 | ChemSpider |