EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12Cl2O4 |
| Net Charge | 0 |
| Average Mass | 279.119 |
| Monoisotopic Mass | 278.01126 |
| SMILES | CCCc1c(Cl)c(OC)c(Cl)c(O)c1C(=O)O |
| InChI | InChI=1S/C11H12Cl2O4/c1-3-4-5-6(11(15)16)9(14)8(13)10(17-2)7(5)12/h14H,3-4H2,1-2H3,(H,15,16) |
| InChIKey | NKSHOWDKAJTSJO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | leaf (BTO:0000713) | MetaboLights (MTBLS3997) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Differanisole A (CHEBI:189327) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| 3,5-dichloro-2-hydroxy-4-methoxy-6-propylbenzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 129497 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:94474-29-0 | ChemIDplus |