EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10NO4 |
| Net Charge | -1 |
| Average Mass | 160.149 |
| Monoisotopic Mass | 160.06153 |
| SMILES | CC(C[C@H]([NH3+])C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C6H11NO4/c1-3(5(8)9)2-4(7)6(10)11/h3-4H,2,7H2,1H3,(H,8,9)(H,10,11)/p-1/t3?,4-/m0/s1 |
| InChIKey | KRKRAOXTGDJWNI-BKLSDQPFSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methyl-L-glutamate(1−) (CHEBI:1893) is a α-amino-acid anion (CHEBI:33558) |
| 4-methyl-L-glutamate(1−) (CHEBI:1893) is conjugate base of 4-methyl-L-glutamic acid (CHEBI:20440) |
| Incoming Relation(s) |
| 4-methyl-L-glutamic acid (CHEBI:20440) is conjugate acid of 4-methyl-L-glutamate(1−) (CHEBI:1893) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-4-methylpentanedioate |
| Synonym | Source |
|---|---|
| (2S)-2-ammonio-4-methylpentanedioate | ChEBI |