EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H34N2O10 |
| Net Charge | 0 |
| Average Mass | 510.540 |
| Monoisotopic Mass | 510.22135 |
| SMILES | CC(C)CCC(=O)OC(C(C)OC(=O)[C@@H](NC(=O)c1cccc(NC=O)c1O)C(C)O)C(C)C(=O)O |
| InChI | InChI=1S/C24H34N2O10/c1-12(2)9-10-18(29)36-21(13(3)23(32)33)15(5)35-24(34)19(14(4)28)26-22(31)16-7-6-8-17(20(16)30)25-11-27/h6-8,11-15,19,21,28,30H,9-10H2,1-5H3,(H,25,27)(H,26,31)(H,32,33)/t13?,14?,15?,19-,21?/m0/s1 |
| InChIKey | ZWWSEVILXVCJCR-BAMAOYLXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | leaf (BTO:0000713) | MetaboLights (MTBLS3997) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Antimycin B1 (CHEBI:189289) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| 4-[(2S)-2-[(3-ormamido-2-hydroxybenzoyl)amino]-3-hydroxybutanoyl]oxy-2-methyl-3-(4-methylpentanoyloxy)pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78445360 | ChemSpider |