EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H51N5O4 |
| Net Charge | 0 |
| Average Mass | 545.769 |
| Monoisotopic Mass | 545.39411 |
| SMILES | CN[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N(C)[C@H](C(=O)NCCc1ccccc1)C(C)C)C(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C30H51N5O4/c1-18(2)23(31-9)27(36)33-24(19(3)4)28(37)34-25(20(5)6)30(39)35(10)26(21(7)8)29(38)32-17-16-22-14-12-11-13-15-22/h11-15,18-21,23-26,31H,16-17H2,1-10H3,(H,32,38)(H,33,36)(H,34,37)/t23-,24-,25-,26-/m0/s1 |
| InChIKey | KTLIZGDBRJCHFU-CQJMVLFOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | leaf (BTO:0000713) | MetaboLights (MTBLS3997) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Rhabdopeptide K (CHEBI:189279) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-3-methyl-2-(methylamino)-N-[(2S)-3-methyl-1-[[(2S)-3-methyl-1-[methyl-[(2S)-3-methyl-1-oxo-1-(2-phenylethylamino)butan-2-yl]amino]-1-oxobutan-2-yl]amino]-1-oxobutan-2-yl]butanamide |