EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H28O5 |
| Net Charge | 0 |
| Average Mass | 324.417 |
| Monoisotopic Mass | 324.19367 |
| SMILES | CC1CC(C)C2C(C1)C(O)C(O)C(C)C2(O)/C=C/C=C/C(=O)O |
| InChI | InChI=1S/C18H28O5/c1-10-8-11(2)15-13(9-10)17(22)16(21)12(3)18(15,23)7-5-4-6-14(19)20/h4-7,10-13,15-17,21-23H,8-9H2,1-3H3,(H,19,20)/b6-4+,7-5+ |
| InChIKey | NAXMPIYZDKZMMN-YDFGWWAZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | leaf (BTO:0000713) | MetaboLights (MTBLS3997) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hynapene A (CHEBI:189255) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2E,4E)-5-(1,3,4-trihydroxy-2,6,8-trimethyl-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-yl)penta-2,4-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4947683 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:155111-89-0 | ChemIDplus |