EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H24N2O4 |
| Net Charge | 0 |
| Average Mass | 272.345 |
| Monoisotopic Mass | 272.17361 |
| SMILES | COC[C@H](/N=[N+]([O-])/C=C/CCCCC(C)=O)[C@H](C)O |
| InChI | InChI=1S/C13H24N2O4/c1-11(16)8-6-4-5-7-9-15(18)14-13(10-19-3)12(2)17/h7,9,12-13,17H,4-6,8,10H2,1-3H3/b9-7+,15-14-/t12-,13-/m0/s1 |
| InChIKey | BRLWDWOZGPKZAD-XLTRDJIWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | leaf (BTO:0000713) | MetaboLights (MTBLS3997) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Elaiomycin D (CHEBI:189249) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| [(2S,3S)-3-hydroxy-1-methoxybutan-2-yl]imino-oxido-[(E)-7-oxooct-1-enyl]azanium |