EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H21Br2O2P |
| Net Charge | 0 |
| Average Mass | 556.234 |
| Monoisotopic Mass | 553.96459 |
| SMILES | Brc1cc2c(cc1CP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1)OCO2 |
| InChI | InChI=1S/C26H21Br2O2P/c27-24-17-26-25(29-19-30-26)16-20(24)18-31(28,21-10-4-1-5-11-21,22-12-6-2-7-13-22)23-14-8-3-9-15-23/h1-17H,18-19H2 |
| InChIKey | CAGDAXOLKAYQLQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | leaf (BTO:0000713) | MetaboLights (MTBLS3997) |
| Roles Classification |
|---|
| Chemical Role: | catalyst A substance that increases the rate of a reaction without modifying the overall standard Gibbs energy change in the reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Bromo[(6-bromo-1,3-benzodioxol-5-yl)methyl]triphenylphosphorane (CHEBI:189237) is a phosphine (CHEBI:35883) |
| IUPAC Name |
|---|
| bromo-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-triphenyl-lambda5-phosphane |
| Manual Xrefs | Databases |
|---|---|
| 30770549 | ChemSpider |